3-amino-2,5-dichlorobenzoic acid,3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea structure
|
Common Name | 3-amino-2,5-dichlorobenzoic acid,3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea | ||
|---|---|---|---|---|
| CAS Number | 11096-81-4 | Molecular Weight | 455.12000 | |
| Density | N/A | Boiling Point | 575.2ºC at 760 mmHg | |
| Molecular Formula | C16H15Cl4N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-amino-2,5-dichlorobenzoic acid,3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 575.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C16H15Cl4N3O4 |
| Molecular Weight | 455.12000 |
| Exact Mass | 452.98200 |
| PSA | 108.38000 |
| LogP | 5.88710 |
| Vapour Pressure | 4.51E-14mmHg at 25°C |
| InChIKey | PZAXUCYPVXMLJJ-UHFFFAOYSA-N |
| SMILES | CON(C)C(=O)Nc1ccc(Cl)c(Cl)c1.Nc1cc(Cl)cc(C(=O)O)c1Cl |
| 3-amino-2,5-dichloro-benzoic acid |
| 3-Amino-2,5-dichlorobenzoic acid mixt. with N'-(3,4-dichlorophenyl)-N-methoxy-N-methylurea |
| 3-(3,4-dichlorophenyl)-1-methoxy-1-methyl-urea |
| Amilon |
| Benzoic acid,3-amino-2,5-dichloro-,mixt. with N'-(3,4-dichlorophenyl)-N-methoxy-N-methylurea |