ethyl 2,2-bis(phenylmethoxy)propanoate
ethyl 2,2-bis(phenylmethoxy)propanoate structure
|
Common Name | ethyl 2,2-bis(phenylmethoxy)propanoate | ||
|---|---|---|---|---|
| CAS Number | 110995-43-2 | Molecular Weight | 314.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Ethyl 2,2-bis(phenylmethoxy)propanoate, Chinese name 乙基2,2-二苯甲氧基丙酸酯, CAS number 110995-43-2, molecular formula C19H22O4, molecular weight 314.37600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2,2-bis(phenylmethoxy)propanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H22O4 |
|---|---|
| Molecular Weight | 314.37600 |
| Exact Mass | 314.15200 |
| PSA | 44.76000 |
| LogP | 3.69930 |
| InChIKey | FPNNUEQPIGDSRV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(OCc1ccccc1)OCc1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~85%
ethyl 2,2-bis(p... CAS#:110995-43-2 |
| Literature: Esswein; Betz; Schmidt Helvetica Chimica Acta, 1989 , vol. 72, # 2 p. 213 - 223 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:90461-25-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,2-Bis(benzyloxy)propionsaeure-ethylester |
| Propanoic acid,2,2-bis(phenylmethoxy)-,ethyl ester |
| ethyl 2,2-bis(benzyloxy)propionate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of ethyl 2,2-bis(phenylmethoxy)propanoate? |
| A: CAS number of ethyl 2,2-bis(phenylmethoxy)propanoate is 110995-43-2. |
| Q: What English synonyms does ethyl 2,2-bis(phenylmethoxy)propanoate have? |
| A: English synonyms of ethyl 2,2-bis(phenylmethoxy)propanoate: 2,2-Bis(benzyloxy)propionsaeure-ethylester, Propanoic acid,2,2-bis(phenylmethoxy)-,ethyl ester, ethyl 2,2-bis(benzyloxy)propionate. |
| Q: What is the Chinese name of 110995-43-2? |
| A: Chinese name of 110995-43-2 is 110995-43-2. |
| Q: What are the downstream products of ethyl 2,2-bis(phenylmethoxy)propanoate? |
| A: Related downstream products(CAS) of ethyl 2,2-bis(phenylmethoxy)propanoate: 90461-25-9. |
| Q: What is the LogP of ethyl 2,2-bis(phenylmethoxy)propanoate? |
| A: LogP of ethyl 2,2-bis(phenylmethoxy)propanoate is 3.69930. |
| Q: What are the upstream materials of ethyl 2,2-bis(phenylmethoxy)propanoate? |
| A: Related upstream materials(CAS) of ethyl 2,2-bis(phenylmethoxy)propanoate: 7476-20-2;100-51-6. |
| Q: What is the InChIKey of ethyl 2,2-bis(phenylmethoxy)propanoate? |
| A: InChIKey of ethyl 2,2-bis(phenylmethoxy)propanoate is FPNNUEQPIGDSRV-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of ethyl 2,2-bis(phenylmethoxy)propanoate? |
| A: SMILES notation of ethyl 2,2-bis(phenylmethoxy)propanoate is CCOC(=O)C(C)(OCc1ccccc1)OCc1ccccc1. |
| Q: What is the polar surface area (PSA) of ethyl 2,2-bis(phenylmethoxy)propanoate? |
| A: Polar surface area (PSA) of ethyl 2,2-bis(phenylmethoxy)propanoate is 44.76000. |
| Q: What is the molecular formula of ethyl 2,2-bis(phenylmethoxy)propanoate? |
| A: Molecular formula of ethyl 2,2-bis(phenylmethoxy)propanoate is C19H22O4. |