4-[2-(3-methoxyphenyl)ethyl]aniline
![4-[2-(3-methoxyphenyl)ethyl]aniline Structure](https://image.chemsrc.com/caspic/064/110997-87-0.png)
4-[2-(3-methoxyphenyl)ethyl]aniline structure
|
Common Name | 4-[2-(3-methoxyphenyl)ethyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 110997-87-0 | Molecular Weight | 227.30200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-(2-(3-Methoxyphenyl)ethyl)aniline, Chinese name 4-(2-(3-甲氧基苯基)乙基)氨基苯, CAS number 110997-87-0, molecular formula C15H17NO, molecular weight 227.30200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[2-(3-methoxyphenyl)ethyl]aniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H17NO |
|---|---|
| Molecular Weight | 227.30200 |
| Exact Mass | 227.13100 |
| PSA | 35.25000 |
| LogP | 3.64380 |
| InChIKey | KVOIZIWCFFTRTE-UHFFFAOYSA-N |
| SMILES | COc1cccc(CCc2ccc(N)cc2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
4-[2-(3-methoxy... CAS#:110997-87-0 |
| Literature: Motoshima, Kazunori; Noguchi-Yachide, Tomomi; Sugita, Kazuyuki; Hashimoto, Yuichi; Ishikawa, Minoru Bioorganic and Medicinal Chemistry, 2009 , vol. 17, # 14 p. 5001 - 5014 |
![1-methoxy-3-[2-(4-nitrophenyl)ethenyl]benzene structure](https://image.chemsrc.com/caspic/241/60822-58-4.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzenamine,4-[2-(3-methoxyphenyl)ethyl] |
| 4-[2-(3-Methoxyphenyl)ethyl]benzenamine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 4-[2-(3-methoxyphenyl)ethyl]aniline? |
| A: Related upstream materials(CAS) of 4-[2-(3-methoxyphenyl)ethyl]aniline: 60822-58-4. |
| Q: What is the Chinese name of 110997-87-0? |
| A: Chinese name of 110997-87-0 is 110997-87-0. |
| Q: What is the molecular weight of 4-[2-(3-methoxyphenyl)ethyl]aniline? |
| A: Molecular weight of 4-[2-(3-methoxyphenyl)ethyl]aniline is 227.30200. |
| Q: What is the SMILES notation of 4-[2-(3-methoxyphenyl)ethyl]aniline? |
| A: SMILES notation of 4-[2-(3-methoxyphenyl)ethyl]aniline is COc1cccc(CCc2ccc(N)cc2)c1. |
| Q: What English synonyms does 4-[2-(3-methoxyphenyl)ethyl]aniline have? |
| A: English synonyms of 4-[2-(3-methoxyphenyl)ethyl]aniline: Benzenamine,4-[2-(3-methoxyphenyl)ethyl], 4-[2-(3-Methoxyphenyl)ethyl]benzenamine. |
| Q: What is the polar surface area (PSA) of 4-[2-(3-methoxyphenyl)ethyl]aniline? |
| A: Polar surface area (PSA) of 4-[2-(3-methoxyphenyl)ethyl]aniline is 35.25000. |
| Q: What is the English name of 4-[2-(3-methoxyphenyl)ethyl]aniline? |
| A: The English name of 4-[2-(3-methoxyphenyl)ethyl]aniline is 4-[2-(3-methoxyphenyl)ethyl]aniline. |
| Q: What is the molecular formula of 4-[2-(3-methoxyphenyl)ethyl]aniline? |
| A: Molecular formula of 4-[2-(3-methoxyphenyl)ethyl]aniline is C15H17NO. |
| Q: What is the LogP of 4-[2-(3-methoxyphenyl)ethyl]aniline? |
| A: LogP of 4-[2-(3-methoxyphenyl)ethyl]aniline is 3.64380. |
| Q: What is the InChIKey of 4-[2-(3-methoxyphenyl)ethyl]aniline? |
| A: InChIKey of 4-[2-(3-methoxyphenyl)ethyl]aniline is KVOIZIWCFFTRTE-UHFFFAOYSA-N. |