Fluoren-9-one, 4-bromo-2,5,7-trinitro-, compd. with 1, 12-dimethylbenzo[c]phenanthrene (1:1) structure
|
Common Name | Fluoren-9-one, 4-bromo-2,5,7-trinitro-, compd. with 1, 12-dimethylbenzo[c]phenanthrene (1:1) | ||
|---|---|---|---|---|
| CAS Number | 1110-83-4 | Molecular Weight | 650.43200 | |
| Density | N/A | Boiling Point | 600.5ºC at 760 mmHg | |
| Molecular Formula | C33H20BrN3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317ºC | |
| Name | 4-bromo-2,5,7-trinitrofluoren-9-one,1,12-dimethylbenzo[c]phenanthrene |
|---|
| Boiling Point | 600.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C33H20BrN3O7 |
| Molecular Weight | 650.43200 |
| Flash Point | 317ºC |
| Exact Mass | 649.04800 |
| PSA | 154.53000 |
| LogP | 10.71770 |
| Vapour Pressure | 2.23E-14mmHg at 25°C |
| InChIKey | YRRZAADYAJAKCY-UHFFFAOYSA-N |
| SMILES | Cc1cccc2ccc3ccc4cccc(C)c4c3c12.O=C1c2cc([N+](=O)[O-])cc(Br)c2-c2c1cc([N+](=O)[O-])cc2[N+](=O)[O-] |