benzyl 3-oxo-2-(phenylhydrazinylidene)butanoate structure
|
Common Name | benzyl 3-oxo-2-(phenylhydrazinylidene)butanoate | ||
|---|---|---|---|---|
| CAS Number | 111033-07-9 | Molecular Weight | 296.32100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl 3-oxo-2-(phenylhydrazinylidene)butanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H16N2O3 |
|---|---|
| Molecular Weight | 296.32100 |
| Exact Mass | 296.11600 |
| PSA | 67.76000 |
| LogP | 2.85990 |
| InChIKey | MBIUMRPJSUIPOJ-AAKCPPNYSA-N |
| SMILES | CC(O)=C(N=Nc1ccccc1)C(=O)OCc1ccccc1 |
|
~88%
benzyl 3-oxo-2-... CAS#:111033-07-9 |
| Literature: Tetrahedron, , vol. 54, # 3-4 p. 359 - 374 |
|
~%
benzyl 3-oxo-2-... CAS#:111033-07-9 |
| Literature: Journal of the Chemical Society, , p. 1474,1481 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Oxo-2-phenylhydrazono-buttersaeure-benzylester |
| 3-oxo-2-phenylhydrazono-butyric acid benzyl ester |
| benzyl 2,3-dioxobutanoate-2-phenylhydrazone |
| benzyl 3-oxo-2-(2-phenylhydrazono)butanoate |
| Butanoic acid,3-oxo-2-(phenylhydrazono)-,phenylmethyl ester |