7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-methylamino-purine-2,6-dione
7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-methylamino-purine-2,6-dione structure
|
Common Name | 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-methylamino-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 111038-26-7 | Molecular Weight | 283.28400 | |
| Density | 1.56g/cm3 | Boiling Point | 574.4ºC at 760mmHg | |
| Molecular Formula | C11H17N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 574.4ºC at 760mmHg |
| Molecular Formula | C11H17N5O4 |
| Molecular Weight | 283.28400 |
| Flash Point | 301.2ºC |
| Exact Mass | 283.12800 |
| PSA | 117.54000 |
| Vapour Pressure | 4.95E-14mmHg at 25°C |
| Index of Refraction | 1.686 |
| InChIKey | PCYJXCVNFNAIHS-UHFFFAOYSA-N |
| SMILES | CNc1nc2c(c(=O)n(C)c(=O)n2C)n1CC(O)CO |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-Purine-2,6-dione,3,7-dihydro-7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino) |
| 1H-Purine-2,6-dione,7-(2,3-dihydroxypropyl)-3,7-dihydro-1,3-dimethyl-8-(methylamino) |
| F2477-0114 |
| 3,7-Dihydro-7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)-1H-purine-2,6-dione |
| 7-(2,3-Dihydroxypropyl)-8-methylaminotheophylline |
| 7-(2,3-DIHYDROXYPROPYL)-1,3-DIMETHYL-8-METHYLAMINO-PURINE-2,6-DIONE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione? |
| A: Boiling point of 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione is 574.4ºC at 760mmHg. |
| Q: What is the English name of 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione? |
| A: The English name of 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione is 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione. |
| Q: What is the CAS number of 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione? |
| A: CAS number of 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione is 111038-26-7. |
| Q: What is the polar surface area (PSA) of 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione? |
| A: Polar surface area (PSA) of 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione is 117.54000. |
| Q: What is the Chinese name of 111038-26-7? |
| A: Chinese name of 111038-26-7 is 111038-26-7. |
| Q: What are the upstream materials of 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione? |
| A: Related upstream materials(CAS) of 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione: 10381-75-6. |
| Q: What is the SMILES notation of 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione? |
| A: SMILES notation of 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione is CNc1nc2c(c(=O)n(C)c(=O)n2C)n1CC(O)CO. |
| Q: What is the molecular weight of 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione? |
| A: Molecular weight of 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione is 283.28400. |
| Q: What English synonyms does 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione have? |
| A: English synonyms of 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione: 1H-Purine-2,6-dione,3,7-dihydro-7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino), 1H-Purine-2,6-dione,7-(2,3-dihydroxypropyl)-3,7-dihydro-1,3-dimethyl-8-(methylamino), F2477-0114, 3,7-Dihydro-7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)-1H-purine-2,6-dione, 7-(2,3-Dihydroxypropyl)-8-methylaminotheophylline, 7-(2,3-DIHYDROXYPROPYL)-1,3-DIMETHYL-8-METHYLAMINO-PURINE-2,6-DIONE. |
| Q: What is the molecular formula of 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione? |
| A: Molecular formula of 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(methylamino)purine-2,6-dione is C11H17N5O4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |