1-azido-2-methoxynaphthalene structure
|
Common Name | 1-azido-2-methoxynaphthalene | ||
|---|---|---|---|---|
| CAS Number | 111180-79-1 | Molecular Weight | 199.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-azido-2-methoxynaphthalene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9N3O |
|---|---|
| Molecular Weight | 199.20900 |
| Exact Mass | 199.07500 |
| PSA | 58.98000 |
| LogP | 3.24296 |
| InChIKey | VCJNGOJFIBVOJT-UHFFFAOYSA-N |
| SMILES | COc1ccc2ccccc2c1N=[N+]=[N-] |
|
~67%
1-azido-2-metho... CAS#:111180-79-1 |
| Literature: Mitchell, Glynn; Rees, Charles W. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 403 - 412 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| Naphthalene,1-azido-2-methoxy |