Propanedioicacid, 2-butyl-2-[2-(dimethylamino)ethyl]-, 1,3-diethyl ester structure
|
Common Name | Propanedioicacid, 2-butyl-2-[2-(dimethylamino)ethyl]-, 1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1112-20-5 | Molecular Weight | 287.39500 | |
| Density | 0.989g/cm3 | Boiling Point | 348.2ºC at 760mmHg | |
| Molecular Formula | C15H29NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.4ºC | |
| Name | diethyl 2-butyl-2-[2-(dimethylamino)ethyl]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.989g/cm3 |
|---|---|
| Boiling Point | 348.2ºC at 760mmHg |
| Molecular Formula | C15H29NO4 |
| Molecular Weight | 287.39500 |
| Flash Point | 164.4ºC |
| Exact Mass | 287.21000 |
| PSA | 55.84000 |
| LogP | 2.24090 |
| Vapour Pressure | 5.13E-05mmHg at 25°C |
| Index of Refraction | 1.454 |
| InChIKey | AULBFGCILFKTCU-UHFFFAOYSA-N |
| SMILES | CCCCC(CCN(C)C)(C(=O)OCC)C(=O)OCC |
|
~%
Propanedioicaci... CAS#:1112-20-5 |
| Literature: Rosenberg; Kneeland; Skinner Journal of the American Chemical Society, 1934 , vol. 56, p. 1340 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| butyl-(2-dimethylamino-ethyl)-malonic acid diethyl ester |
| 1-Dimethylamino-heptan-dicarbonsaeure-(3.3)-diaethylester |
| diethyl butyl[2-(dimethylamino)ethyl]propanedioate |
| Butyl-(2-dimethylamino-aethyl)-malonsaeure-diaethylester |