1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-N-(3-chloro-4-fluorobenzyl)piperidine-4-carboxamide structure
|
Common Name | 1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-N-(3-chloro-4-fluorobenzyl)piperidine-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1112292-75-7 | Molecular Weight | 438.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H20ClFN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-N-(3-chloro-4-fluorobenzyl)piperidine-4-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H20ClFN4O2 |
|---|---|
| Molecular Weight | 438.9 |
| InChIKey | XZYNAAWXUGVFKU-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccc(F)c(Cl)c1)C1CCN(c2ncnc3c2oc2ccccc23)CC1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: High-throughput screen for inhibitors of the GIV GBA-motif interaction with Galpha-i ...
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
External Id: HMS1303
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-N-(3-chloro-4-fluorobenzyl)piperidine-4-carboxamide? |
| A: Molecular weight of 1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-N-(3-chloro-4-fluorobenzyl)piperidine-4-carboxamide is 438.9. |
| Q: What is the CAS number of 1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-N-(3-chloro-4-fluorobenzyl)piperidine-4-carboxamide? |
| A: CAS number of 1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-N-(3-chloro-4-fluorobenzyl)piperidine-4-carboxamide is 1112292-75-7. |
| Q: What is the English name of 1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-N-(3-chloro-4-fluorobenzyl)piperidine-4-carboxamide? |
| A: The English name of 1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-N-(3-chloro-4-fluorobenzyl)piperidine-4-carboxamide is 1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-N-(3-chloro-4-fluorobenzyl)piperidine-4-carboxamide. |
| Q: What is the Chinese name of 1112292-75-7? |
| A: Chinese name of 1112292-75-7 is 1112292-75-7. |
| Q: What is the molecular formula of 1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-N-(3-chloro-4-fluorobenzyl)piperidine-4-carboxamide? |
| A: Molecular formula of 1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-N-(3-chloro-4-fluorobenzyl)piperidine-4-carboxamide is C23H20ClFN4O2. |
| Q: What is the InChIKey of 1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-N-(3-chloro-4-fluorobenzyl)piperidine-4-carboxamide? |
| A: InChIKey of 1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-N-(3-chloro-4-fluorobenzyl)piperidine-4-carboxamide is XZYNAAWXUGVFKU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-N-(3-chloro-4-fluorobenzyl)piperidine-4-carboxamide? |
| A: SMILES notation of 1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-N-(3-chloro-4-fluorobenzyl)piperidine-4-carboxamide is O=C(NCc1ccc(F)c(Cl)c1)C1CCN(c2ncnc3c2oc2ccccc23)CC1. |