2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one
Modify Date: 2026-07-05 17:09:21
![2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one Structure](https://www.chemsrc.com/extcaspic/167/1112440-69-3.png)
2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one structure
|
Common Name | 2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 1112440-69-3 | Molecular Weight | 420.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H17ClN4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H17ClN4O3 |
|---|---|
| Molecular Weight | 420.8 |
| InChIKey | RLSMXQMXHMRFKI-UHFFFAOYSA-N |
| SMILES | O=C(Cn1cc(-c2nc(-c3ccc(Cl)cc3)no2)ccc1=O)NCc1ccccc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one? |
| A: InChIKey of 2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one is RLSMXQMXHMRFKI-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one? |
| A: CAS number of 2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one is 1112440-69-3. |
| Q: What is the molecular weight of 2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one? |
| A: Molecular weight of 2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one is 420.8. |
| Q: What is the Chinese name of 1112440-69-3? |
| A: Chinese name of 1112440-69-3 is 1112440-69-3. |
| Q: What is the molecular formula of 2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one? |
| A: Molecular formula of 2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one is C22H17ClN4O3. |
| Q: What is the SMILES notation of 2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one? |
| A: SMILES notation of 2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one is O=C(Cn1cc(-c2nc(-c3ccc(Cl)cc3)no2)ccc1=O)NCc1ccccc1. |
| Q: What is the English name of 2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one? |
| A: The English name of 2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one is 2-[(2,5-dimethylbenzyl)thio]-3-ethyl-6-phenylthieno[3,2-d]pyrimidin-4(3H)-one. |