3-[4-(dimethylamino)phenyl]imidazolidine-2,4-dione structure
|
Common Name | 3-[4-(dimethylamino)phenyl]imidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 111256-82-7 | Molecular Weight | 219.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[4-(dimethylamino)phenyl]imidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13N3O2 |
|---|---|
| Molecular Weight | 219.24000 |
| Exact Mass | 219.10100 |
| PSA | 56.14000 |
| LogP | 0.51380 |
| InChIKey | CRRZYZAAYYKGSZ-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(N2C(=O)CNC2=O)cc1 |
|
~%
3-[4-(dimethyla... CAS#:111256-82-7 |
| Literature: Ryczek, Jozef Journal of Heterocyclic Chemistry, 2002 , vol. 39, # 5 p. 997 - 1000 |
|
~%
3-[4-(dimethyla... CAS#:111256-82-7 |
| Literature: Mindl, Jaromir; Sterba, Vojeslav Collection of Czechoslovak Chemical Communications, 1987 , vol. 52, # 1 p. 156 - 161 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4-Imidazolidinedione,3-[4-(dimethylamino)phenyl] |