methyl 4-phenylpiperazine-1-carbodithioate structure
|
Common Name | methyl 4-phenylpiperazine-1-carbodithioate | ||
|---|---|---|---|---|
| CAS Number | 111277-67-9 | Molecular Weight | 252.39900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-phenylpiperazine-1-carbodithioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16N2S2 |
|---|---|
| Molecular Weight | 252.39900 |
| Exact Mass | 252.07500 |
| PSA | 63.87000 |
| LogP | 2.45940 |
| InChIKey | VLFWPTVAVRTYIU-UHFFFAOYSA-N |
| SMILES | CSC(=S)N1CCN(c2ccccc2)CC1 |
|
~%
methyl 4-phenyl... CAS#:111277-67-9 |
| Literature: Spalinska, Katarzyna; Foks, Henryk; Kedzia, Anna; Wierzbowska, Marta; Kwapisz, Ewa; Gebska, Alina; Ziolkowska-Klinkosz, Marta Phosphorus, Sulfur and Silicon and the Related Elements, 2006 , vol. 181, # 3 p. 609 - 625 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-Piperazinecarbodithioic acid,4-phenyl-,methyl ester |
| 4-phenylpiperazin-1-yldithiocarbazoic acid methyl ester |