4-Nitrophenyl3-diazopyruvate structure
|
Common Name | 4-Nitrophenyl3-diazopyruvate | ||
|---|---|---|---|---|
| CAS Number | 111337-51-0 | Molecular Weight | 235.15300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (Z)-1-diazonio-3-(4-nitrophenoxy)-3-oxoprop-1-en-2-olate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H5N3O5 |
|---|---|
| Molecular Weight | 235.15300 |
| Exact Mass | 235.02300 |
| PSA | 123.33000 |
| LogP | 2.14838 |
| InChIKey | VCRPKWLNHWPCSR-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=CC(=O)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
|
~49%
4-Nitrophenyl3-... CAS#:111337-51-0 |
| Literature: Photochemistry and Photobiology, , vol. 76, # 5 p. 473 - 479 |
|
~%
4-Nitrophenyl3-... CAS#:111337-51-0 |
| Literature: Photochemistry and Photobiology, , vol. 76, # 5 p. 473 - 479 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Dappnp |
| p-nitrophenyl 3-diazopyruvate |
| 4-Nitrophenyl 3-diazopyruvate |