Benzo[b]thiophen-2-amine, 6-Methoxy-N,N-dimethyl- structure
|
Common Name | Benzo[b]thiophen-2-amine, 6-Methoxy-N,N-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 111359-29-6 | Molecular Weight | 207.29200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-Methoxy-N,N-dimethyl-1-benzothiophen-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13NOS |
|---|---|
| Molecular Weight | 207.29200 |
| Exact Mass | 207.07200 |
| PSA | 40.71000 |
| LogP | 2.97590 |
| InChIKey | ZCAAGYZRPASSPU-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(S1)C=C(C=C2)OC |
| HS Code | 2934999090 |
|---|
|
~76%
Benzo[b]thiophe... CAS#:111359-29-6 |
| Literature: ELI LILLY AND COMPANY Patent: EP773217 A1, 1997 ; |
|
~82%
Benzo[b]thiophe... CAS#:111359-29-6 |
| Literature: Lee, Kyo Chul; Moon, Byung Seok; Lee, Jae Hak; Chung, Kyoo-Hyun; Katzenellenbogen, John A.; Chi, Dae Yoon Bioorganic and Medicinal Chemistry, 2003 , vol. 11, # 17 p. 3649 - 3658 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzo[b]thiophen-2-amine,6-methoxy-N,N-dimethyl |
| (6-methoxy-benzo[b]thiophen-2-yl)-dimethyl-amine |
| 6-Methoxy-N,N-dimethylbenzo[b]thiophen-2-amine |
| N-(6-methoxy-1-benzothien-2-yl)-N,N-dimethylamine |
| 2-(dimethylamino)-6-methoxybenzothiophene |
| 2-dimethylamino-6-methoxybenzo[b] thiophene |