Bis(pentamethylcyclopentadienyl)dicarbonyltitanium(II) structure
|
Common Name | Bis(pentamethylcyclopentadienyl)dicarbonyltitanium(II) | ||
|---|---|---|---|---|
| CAS Number | 11136-40-6 | Molecular Weight | 374.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H30O2Ti | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(oxomethylidene)titanium,1,2,3,5,5-pentamethylcyclopenta-1,3-diene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H30O2Ti |
|---|---|
| Molecular Weight | 374.33900 |
| Exact Mass | 374.17300 |
| LogP | 5.80820 |
| InChIKey | FQPWGFQBXGGXIK-UHFFFAOYSA-N |
| SMILES | CC1=[C-]C(C)(C)C(C)=C1C.CC1=[C-]C(C)(C)C(C)=C1C.O=C=[Ti]=C=O |
|
~65%
Bis(pentamethyl... CAS#:11136-40-6 |
| Literature: Sikora, David J.; Rausch, Marvin D.; Rogers, Robin D.; Atwood, Jerry L. Journal of the American Chemical Society, 1981 , vol. 103, p. 1265 - 1267 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| dicarbonylpermethyltitanocene |
| Titanium,dicarbonylbis(pentamethyl-p-cyclopentadienyl)-(8CI) |
| Titanium,dicarbonylbis[(1,2,3,4,5-h)-1,2,3,4,5-pentamethyl-2,4-cyclopentadien-1-yl] |
| Dicarbonylbis(pentamethylcyclopentadienyl)titanium |
| 1,3-Cyclopentadiene,1,2,3,4,5-pentamethyl-,titanium complex |