(5-benzylfuran-3-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate,5-[2-(2-butoxyethoxy)ethoxymethyl]-6-propyl-1,3-benzodioxole structure
|
Common Name | (5-benzylfuran-3-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate,5-[2-(2-butoxyethoxy)ethoxymethyl]-6-propyl-1,3-benzodioxole | ||
|---|---|---|---|---|
| CAS Number | 111376-59-1 | Molecular Weight | 676.87900 | |
| Density | N/A | Boiling Point | 415.6ºC at 760mmHg | |
| Molecular Formula | C41H56O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.2ºC | |
| Name | (5-benzylfuran-3-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate,5-[2-(2-butoxyethoxy)ethoxymethyl]-6-propyl-1,3-benzodioxole |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 415.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C41H56O8 |
| Molecular Weight | 676.87900 |
| Flash Point | 205.2ºC |
| Exact Mass | 676.39800 |
| PSA | 85.59000 |
| LogP | 8.86970 |
| Vapour Pressure | 4.07E-07mmHg at 25°C |
| InChIKey | LLGCSIYAKIIVFJ-UHFFFAOYSA-N |
| SMILES | CC(C)=CC1C(C(=O)OCc2coc(Cc3ccccc3)c2)C1(C)C.CCCCOCCOCCOCc1cc2c(cc1CCC)OCO2 |
| Resmethrin mixture with piperonyl butoxide |
| Cyclopropanecarboxylic acid,2,2-dimethyl-3-(2-methyl-1-propenyl)-,(5-(phenylmethyl)-3-furanyl)methyl ester,mixt. with 5-((2-(2-butoxyethoxy)ethoxy)methyl)-6-propyl-1,3-benzodioxole |
| Resmethrin mixt. with piperonyl butoxide |