2-Butenedioic acid,2,3-dichloro-, dimethyl ester, (2Z)- (9CI) structure
|
Common Name | 2-Butenedioic acid,2,3-dichloro-, dimethyl ester, (2Z)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 1114-23-4 | Molecular Weight | 213.01500 | |
| Density | 1.415g/cm3 | Boiling Point | 252.8ºC at 760 mmHg | |
| Molecular Formula | C6H6Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.4ºC | |
| Name | dimethyl (Z)-2,3-dichlorobut-2-enedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.415g/cm3 |
|---|---|
| Boiling Point | 252.8ºC at 760 mmHg |
| Molecular Formula | C6H6Cl2O4 |
| Molecular Weight | 213.01500 |
| Flash Point | 106.4ºC |
| Exact Mass | 211.96400 |
| PSA | 52.60000 |
| LogP | 1.02160 |
| Vapour Pressure | 0.0189mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | YGDFORZEKOJPAN-ONEGZZNKSA-N |
| SMILES | COC(=O)C(Cl)=C(Cl)C(=O)OC |
|
~%
2-Butenedioic a... CAS#:1114-23-4 |
| Literature: Kauder Journal fuer Praktische Chemie (Leipzig), 1885 , vol. <2> 31, p. 4,6, 8 Full Text Show Details Eldred; Young Journal of the American Chemical Society, 1953 , vol. 75, p. 4338 |
| dichloromaleic acid dimethyl ester |
| dibromo-malonic acid dimethyl ester |
| Dichlormaleinsaeure-dimethylester |
| Dichlormaleinsaeeure-dimethylester |
| dimethyl dichloromaleate |
| dimethyl 2,2-dibromomalonate |
| Dibrom-malonsaeure-dimethylester |
| dimethyl 2,3-dichloromaleate |
| Propandioic acid,dibromo-,dimethyl ester |
| Dimethyl dibromomalonate |