[4-(4-bromophenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-methylphenyl)methanone
Modify Date: 2026-09-20 19:47:30
methanone Structure](https://www.chemsrc.com/extcaspic/117/1114652-90-2.png)
[4-(4-bromophenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-methylphenyl)methanone structure
|
Common Name | [4-(4-bromophenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-methylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 1114652-90-2 | Molecular Weight | 454.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H16BrNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [4-(4-bromophenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-methylphenyl)methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H16BrNO3S |
|---|---|
| Molecular Weight | 454.3 |
| InChIKey | XEXWDSBTFOQYTI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)C2=CN(c3ccc(Br)cc3)c3ccccc3S2(=O)=O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of [4-(4-bromophenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-methylphenyl)methanone? |
| A: InChIKey of [4-(4-bromophenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-methylphenyl)methanone is XEXWDSBTFOQYTI-UHFFFAOYSA-N. |
| Q: What is the molecular weight of [4-(4-bromophenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-methylphenyl)methanone? |
| A: Molecular weight of [4-(4-bromophenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-methylphenyl)methanone is 454.3. |
| Q: What is the molecular formula of [4-(4-bromophenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-methylphenyl)methanone? |
| A: Molecular formula of [4-(4-bromophenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-methylphenyl)methanone is C22H16BrNO3S. |
| Q: What is the Chinese name of 1114652-90-2? |
| A: Chinese name of 1114652-90-2 is 1114652-90-2. |
| Q: What is the CAS number of [4-(4-bromophenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-methylphenyl)methanone? |
| A: CAS number of [4-(4-bromophenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-methylphenyl)methanone is 1114652-90-2. |
| Q: What is the SMILES notation of [4-(4-bromophenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-methylphenyl)methanone? |
| A: SMILES notation of [4-(4-bromophenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-methylphenyl)methanone is Cc1ccc(C(=O)C2=CN(c3ccc(Br)cc3)c3ccccc3S2(=O)=O)cc1. |
| Q: What is the English name of [4-(4-bromophenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-methylphenyl)methanone? |
| A: The English name of [4-(4-bromophenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-methylphenyl)methanone is [4-(4-bromophenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-methylphenyl)methanone. |