1-(5-(2,2,2-TRICHLOROACETYL)-1H-PYRROL-3-YL)BUTAN-1-ONE structure
|
Common Name | 1-(5-(2,2,2-TRICHLOROACETYL)-1H-PYRROL-3-YL)BUTAN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 111468-91-8 | Molecular Weight | 282.55100 | |
| Density | 1.426g/cm3 | Boiling Point | 403.1ºC at 760mmHg | |
| Molecular Formula | C10H10Cl3NO2 | Melting Point | 133-135ºC | |
| MSDS | N/A | Flash Point | 197.6ºC | |
| Name | 1-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.426g/cm3 |
|---|---|
| Boiling Point | 403.1ºC at 760mmHg |
| Melting Point | 133-135ºC |
| Molecular Formula | C10H10Cl3NO2 |
| Molecular Weight | 282.55100 |
| Flash Point | 197.6ºC |
| Exact Mass | 280.97800 |
| PSA | 49.93000 |
| LogP | 3.55040 |
| Vapour Pressure | 1.04E-06mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | QKOKEVWDNCJQHW-UHFFFAOYSA-N |
| SMILES | CCCC(=O)c1c[nH]c(C(=O)C(Cl)(Cl)Cl)c1 |
| HS Code | 2933990090 |
|---|
|
~81%
1-(5-(2,2,2-TRI... CAS#:111468-91-8 |
| Literature: Garrido, Daniel O. A.; Buldain, Graciela; Ojea, Maria I.; Frydman, Benjamin Journal of Organic Chemistry, 1988 , vol. 53, # 2 p. 403 - 407 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| trichloroacetylpyrrolylbutanone |
| 1-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]-1-butanone |
| 4-butyryl-2-trichloroacetylpyrrole |
| 1-(5-(2,2,2-Trichloroacetyl)-1H-pyrrol-3-yl)butan-1-one |