7-ETHYLINDOLE-3-GLYOXYLIC ACID ETHYL ESTER structure
|
Common Name | 7-ETHYLINDOLE-3-GLYOXYLIC ACID ETHYL ESTER | ||
|---|---|---|---|---|
| CAS Number | 111478-90-1 | Molecular Weight | 245.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15NO3 |
|---|---|
| Molecular Weight | 245.27400 |
| Exact Mass | 245.10500 |
| PSA | 59.16000 |
| LogP | 2.47610 |
| InChIKey | GNBNYDFJCJIVKD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)c1c[nH]c2c(CC)cccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~67%
7-ETHYLINDOLE-3... CAS#:111478-90-1 |
| Literature: US4686213 A1, ; |
|
~%
7-ETHYLINDOLE-3... CAS#:111478-90-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 31, # 9 p. 1712 - 1719 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 2 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 7-ETHYLINDOLE-3-GLYOXYLIC ACID ETHYL ESTER |
| 1H-Indole-3-aceticacid,7-ethyl-a-oxo-,ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate? |
| A: Molecular formula of ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate is C14H15NO3. |
| Q: What is the Chinese name of 111478-90-1? |
| A: Chinese name of 111478-90-1 is 111478-90-1. |
| Q: What English synonyms does ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate have? |
| A: English synonyms of ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate: 7-ETHYLINDOLE-3-GLYOXYLIC ACID ETHYL ESTER, 1H-Indole-3-aceticacid,7-ethyl-a-oxo-,ethyl ester. |
| Q: What is the polar surface area (PSA) of ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate? |
| A: Polar surface area (PSA) of ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate is 59.16000. |
| Q: What is the LogP of ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate? |
| A: LogP of ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate is 2.47610. |
| Q: What is the SMILES notation of ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate? |
| A: SMILES notation of ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate is CCOC(=O)C(=O)c1c[nH]c2c(CC)cccc12. |
| Q: What is the English name of ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate? |
| A: The English name of ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate is ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate. |
| Q: What is the molecular weight of ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate? |
| A: Molecular weight of ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate is 245.27400. |
| Q: What are the downstream products of ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate? |
| A: Related downstream products(CAS) of ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate: 111478-86-5;111478-84-3. |
| Q: What is the CAS number of ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate? |
| A: CAS number of ethyl 2-(7-ethyl-1H-indol-3-yl)-2-oxoacetate is 111478-90-1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |