2-Pyrrolidinone, 4-amino-1-[(4-methylphenyl)methyl] structure
|
Common Name | 2-Pyrrolidinone, 4-amino-1-[(4-methylphenyl)methyl] | ||
|---|---|---|---|---|
| CAS Number | 1114822-39-7 | Molecular Weight | 204.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Pyrrolidinone, 4-amino-1-[(4-methylphenyl)methyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16N2O |
|---|---|
| Molecular Weight | 204.27 |
| InChIKey | DRIOZWZFPKFQQC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CN2CC(N)CC2=O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-Pyrrolidinone, 4-amino-1-[(4-methylphenyl)methyl]? |
| A: InChIKey of 2-Pyrrolidinone, 4-amino-1-[(4-methylphenyl)methyl] is DRIOZWZFPKFQQC-UHFFFAOYSA-N. |
| Q: What is the English name of 2-Pyrrolidinone, 4-amino-1-[(4-methylphenyl)methyl]? |
| A: The English name of 2-Pyrrolidinone, 4-amino-1-[(4-methylphenyl)methyl] is 2-Pyrrolidinone, 4-amino-1-[(4-methylphenyl)methyl]. |
| Q: What is the Chinese name of 1114822-39-7? |
| A: Chinese name of 1114822-39-7 is 1114822-39-7. |
| Q: What is the CAS number of 2-Pyrrolidinone, 4-amino-1-[(4-methylphenyl)methyl]? |
| A: CAS number of 2-Pyrrolidinone, 4-amino-1-[(4-methylphenyl)methyl] is 1114822-39-7. |
| Q: What is the molecular formula of 2-Pyrrolidinone, 4-amino-1-[(4-methylphenyl)methyl]? |
| A: Molecular formula of 2-Pyrrolidinone, 4-amino-1-[(4-methylphenyl)methyl] is C12H16N2O. |
| Q: What is the SMILES notation of 2-Pyrrolidinone, 4-amino-1-[(4-methylphenyl)methyl]? |
| A: SMILES notation of 2-Pyrrolidinone, 4-amino-1-[(4-methylphenyl)methyl] is Cc1ccc(CN2CC(N)CC2=O)cc1. |
| Q: What is the molecular weight of 2-Pyrrolidinone, 4-amino-1-[(4-methylphenyl)methyl]? |
| A: Molecular weight of 2-Pyrrolidinone, 4-amino-1-[(4-methylphenyl)methyl] is 204.27. |