(S)-2-Azido-3,3-dimethylbutanoicacid structure
|
Common Name | (S)-2-Azido-3,3-dimethylbutanoicacid | ||
|---|---|---|---|---|
| CAS Number | 111525-71-4 | Molecular Weight | 157.17000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (S)-α-azido-3,3-dimethyl butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H11N3O2 |
|---|---|
| Molecular Weight | 157.17000 |
| Exact Mass | 157.08500 |
| PSA | 87.05000 |
| LogP | 1.24876 |
| InChIKey | VAIDLLPVBKRXOK-SCSAIBSYSA-N |
| SMILES | CC(C)(C)C(N=[N+]=[N-])C(=O)O |
|
~%
(S)-2-Azido-3,3... CAS#:111525-71-4 |
| Literature: Evans, David A.; Britton, Thomas C. Journal of the American Chemical Society, 1987 , vol. 109, # 22 p. 6881 - 6883 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| .2(S)-azido-3,3-dimethylbutanoic acid |
| .azido-tert-Leu |
| (S)-2-azido-3,3-dimethylbutanoic acid |