4-METHOXY-5-NITRO-2,3-DIHYDRO-1H-INDEN-1-ONE structure
|
Common Name | 4-METHOXY-5-NITRO-2,3-DIHYDRO-1H-INDEN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 1116359-18-2 | Molecular Weight | 207.18300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methoxy-5-nitro-2,3-dihydroinden-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9NO4 |
|---|---|
| Molecular Weight | 207.18300 |
| Exact Mass | 207.05300 |
| PSA | 72.12000 |
| LogP | 2.25550 |
| InChIKey | NKNFHZYVTNSHIX-UHFFFAOYSA-N |
| SMILES | COc1c([N+](=O)[O-])ccc2c1CCC2=O |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-methoxy-5-nitro-1-indanone |
| 4-Methoxy-5-nitro-2,3-dihydro-1H-inden-1-one |