Heptakis-(2,6-di-O-ethyl)-β-cyclodextrin structure
|
Common Name | Heptakis-(2,6-di-O-ethyl)-β-cyclodextrin | ||
|---|---|---|---|---|
| CAS Number | 111689-03-3 | Molecular Weight | 1309.48000 | |
| Density | 1.3g/cm3 | Boiling Point | 1270.4ºC at 760mmHg | |
| Molecular Formula | C60H108O30 | Melting Point | -215ºC (dec.) | |
| MSDS | N/A | Flash Point | 722.1ºC | |
Use of Heptakis-(2,6-di-O-ethyl)-β-cyclodextrinHeptakis-(2,6-di-O-ethyl)-β-cyclodextrin is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 2,6-Di-O-ethyl-β-cyclodextrin |
|---|
| Description | Heptakis-(2,6-di-O-ethyl)-β-cyclodextrin is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 1270.4ºC at 760mmHg |
| Melting Point | -215ºC (dec.) |
| Molecular Formula | C60H108O30 |
| Molecular Weight | 1309.48000 |
| Flash Point | 722.1ºC |
| Exact Mass | 1308.69000 |
| PSA | 342.90000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | PLHMLIDUVYHXHF-ZQSHRCRISA-N |
| SMILES | CCOCC1OC2OC3C(COCC)OC(OC4C(COCC)OC(OC5C(COCC)OC(OC6C(COCC)OC(OC7C(COCC)OC(OC8C(COCC)OC(OC1C(O)C2OCC)C(OCC)C8O)C(OCC)C7O)C(OCC)C6O)C(OCC)C5O)C(OCC)C4O)C(OCC)C3O |
| WGK Germany | 3 |
|---|