5-ethoxy-1-(4-methoxyphenyl)sulfonylpyrrolidin-2-one structure
|
Common Name | 5-ethoxy-1-(4-methoxyphenyl)sulfonylpyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 111711-51-4 | Molecular Weight | 299.34300 | |
| Density | 1.34g/cm3 | Boiling Point | 438.9ºC at 760mmHg | |
| Molecular Formula | C13H17NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.2ºC | |
| Name | 5-ethoxy-1-(4-methoxyphenyl)sulfonylpyrrolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 438.9ºC at 760mmHg |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.34300 |
| Flash Point | 219.2ºC |
| Exact Mass | 299.08300 |
| PSA | 81.29000 |
| LogP | 2.38760 |
| Vapour Pressure | 6.67E-08mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | IVUHPMCTIQUPFF-UHFFFAOYSA-N |
| SMILES | CCOC1CCC(=O)N1S(=O)(=O)c1ccc(OC)cc1 |
|
~%
5-ethoxy-1-(4-m... CAS#:111711-51-4 |
| Literature: Toja, E; Gorini, C; Zirotti, C; Barzaghi, F; Galliani, G European Journal of Medicinal Chemistry, 1991 , vol. 26, # 4 p. 403 - 413 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Pyrrolidinone,5-ethoxy-1-((4-methoxyphenyl)sulfonyl) |
| 1-(4-Methoxybenzenesulphonyl)-2-oxo-5-ethoxypyrrolidine |
| 5-Ethoxy-1-((4-methoxyphenyl)sulfonyl)-2-pyrrolidinone |