5-ethoxy-1-(4-methylphenyl)sulfonylpyrrolidin-2-one structure
|
Common Name | 5-ethoxy-1-(4-methylphenyl)sulfonylpyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 111711-61-6 | Molecular Weight | 283.34300 | |
| Density | 1.31g/cm3 | Boiling Point | 416.1ºC at 760mmHg | |
| Molecular Formula | C13H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.5ºC | |
| Name | 5-ethoxy-1-(4-methylphenyl)sulfonylpyrrolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 416.1ºC at 760mmHg |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.34300 |
| Flash Point | 205.5ºC |
| Exact Mass | 283.08800 |
| PSA | 72.06000 |
| LogP | 2.68740 |
| Vapour Pressure | 3.91E-07mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | LSIPRUFFORHIQN-UHFFFAOYSA-N |
| SMILES | CCOC1CCC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
|
~80%
5-ethoxy-1-(4-m... CAS#:111711-61-6 |
| Literature: Luker, Tim; Hiemstra, Henk; Nico Speckamp Journal of Organic Chemistry, 1997 , vol. 62, # 23 p. 8131 - 8140 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Pyrrolidinone,5-ethoxy-1-((4-methylphenyl)sulfonyl) |
| 5-Ethoxy-1-((4-methylphenyl)sulfonyl)-2-pyrrolidinone |
| 5-ethoxy-1-p-toluenesulfonyl-2-pyrrolidinone |