5-ethoxy-1-thiophen-3-ylsulfonylpyrrolidin-2-one structure
|
Common Name | 5-ethoxy-1-thiophen-3-ylsulfonylpyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 111711-67-2 | Molecular Weight | 275.34500 | |
| Density | 1.44g/cm3 | Boiling Point | 415.7ºC at 760mmHg | |
| Molecular Formula | C10H13NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.2ºC | |
| Name | 5-ethoxy-1-thiophen-3-ylsulfonylpyrrolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 415.7ºC at 760mmHg |
| Molecular Formula | C10H13NO4S2 |
| Molecular Weight | 275.34500 |
| Flash Point | 205.2ºC |
| Exact Mass | 275.02900 |
| PSA | 100.30000 |
| LogP | 2.44050 |
| Vapour Pressure | 4.04E-07mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | XXDYMSGLQVUDLM-UHFFFAOYSA-N |
| SMILES | CCOC1CCC(=O)N1S(=O)(=O)c1ccsc1 |
|
~%
5-ethoxy-1-thio... CAS#:111711-67-2 |
| Literature: Toja, E; Gorini, C; Zirotti, C; Barzaghi, F; Galliani, G European Journal of Medicinal Chemistry, 1991 , vol. 26, # 4 p. 403 - 413 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Ethoxy-1-(3-thienylsulfonyl)-2-pyrrolidinone |
| 2-Pyrrolidinone,5-ethoxy-1-(3-thienylsulfonyl) |
| 5-ethoxy-1-[(3-thienyl)-sulphonyl]-2-pyrrolidinone |