1-(3-acetylphenyl)sulfonyl-5-ethoxypyrrolidin-2-one structure
|
Common Name | 1-(3-acetylphenyl)sulfonyl-5-ethoxypyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 111711-76-3 | Molecular Weight | 311.35300 | |
| Density | 1.35g/cm3 | Boiling Point | 480.3ºC at 760 mmHg | |
| Molecular Formula | C14H17NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3-acetylphenyl)sulfonyl-5-ethoxypyrrolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 480.3ºC at 760 mmHg |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.35300 |
| Exact Mass | 311.08300 |
| PSA | 89.13000 |
| LogP | 2.58160 |
| Vapour Pressure | 2.2E-09mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | FBUOKKICTXSLLX-UHFFFAOYSA-N |
| SMILES | CCOC1CCC(=O)N1S(=O)(=O)c1cccc(C(C)=O)c1 |
|
~%
1-(3-acetylphen... CAS#:111711-76-3 |
| Literature: Toja, E; Gorini, C; Zirotti, C; Barzaghi, F; Galliani, G European Journal of Medicinal Chemistry, 1991 , vol. 26, # 4 p. 403 - 413 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Pyrrolidinone,1-((3-acetylphenyl)sulfonyl)-5-ethoxy |
| 1-((3-Acetylphenyl)sulfonyl)-5-ethoxy-2-pyrrolidinone |