1-(benzenesulfonyl)-5-hydroxypyrrolidin-2-one structure
|
Common Name | 1-(benzenesulfonyl)-5-hydroxypyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 111711-97-8 | Molecular Weight | 241.26400 | |
| Density | 1.502g/cm3 | Boiling Point | 432.8ºC at 760 mmHg | |
| Molecular Formula | C10H11NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.5ºC | |
| Name | 1-(benzenesulfonyl)-5-hydroxypyrrolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.502g/cm3 |
|---|---|
| Boiling Point | 432.8ºC at 760 mmHg |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.26400 |
| Flash Point | 215.5ºC |
| Exact Mass | 241.04100 |
| PSA | 83.06000 |
| LogP | 1.33480 |
| Vapour Pressure | 2.94E-08mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | LJDRTKSCZIXLQV-UHFFFAOYSA-N |
| SMILES | O=C1CCC(O)N1S(=O)(=O)c1ccccc1 |
|
~%
1-(benzenesulfo... CAS#:111711-97-8 |
| Literature: European Journal of Medicinal Chemistry, , vol. 26, # 4 p. 403 - 413 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Pyrrolidinone,5-hydroxy-1-(phenylsulfonyl) |
| 1-benzenesulphonyl-2-oxo-5-hydroxypyrrolidine |
| 5-hydroxy-1-phenylsulfonyl-2-pyrrolidinone |