4-((5-methyl-2-oxo-1,3-dioxol-4-yl)methylthio)benzenesulfonate structure
|
Common Name | 4-((5-methyl-2-oxo-1,3-dioxol-4-yl)methylthio)benzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 111738-22-8 | Molecular Weight | 324.30500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9NaO6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,4-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylsulfanyl]benzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9NaO6S2 |
|---|---|
| Molecular Weight | 324.30500 |
| Exact Mass | 323.97400 |
| PSA | 134.23000 |
| LogP | 2.81840 |
| InChIKey | ZTGLVELRRYXRCP-UHFFFAOYSA-M |
| SMILES | Cc1oc(=O)oc1CSc1ccc(S(=O)(=O)[O-])cc1.[Na+] |
|
~59%
4-((5-methyl-2-... CAS#:111738-22-8 |
| Literature: Kawai; Sakamoto; Taguchi; Kitamura; Sotomura; Tsukamoto Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 6 p. 1422 - 1425 |
|
~%
4-((5-methyl-2-... CAS#:111738-22-8 |
| Literature: Kawai; Sakamoto; Taguchi; Kitamura; Sotomura; Tsukamoto Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 6 p. 1422 - 1425 |
|
~%
4-((5-methyl-2-... CAS#:111738-22-8 |
| Literature: Kawai; Sakamoto; Taguchi; Kitamura; Sotomura; Tsukamoto Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 6 p. 1422 - 1425 |
| MODBS |
| sodium 4-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylthio]benzenesulfonate |
| Benzenesulfonic acid,4-[[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl]thio]-,sodium salt (1:1) |
| 4-((5-Methyl-2-oxo-1,3-dioxol-4-yl)methylthio)benzenesulfonate |
| sodium 4-{[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl]sulfanyl}benzenesulfonate |