1-naphthalen-1-yl-3-(4-nitrophenyl)thiourea structure
|
Common Name | 1-naphthalen-1-yl-3-(4-nitrophenyl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 111782-25-3 | Molecular Weight | 323.36900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-naphthalen-1-yl-3-(4-nitrophenyl)thiourea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H13N3O2S |
|---|---|
| Molecular Weight | 323.36900 |
| Exact Mass | 323.07300 |
| PSA | 109.01000 |
| LogP | 5.37360 |
| InChIKey | GJDRSYLDJPWOMT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NC(=S)Nc2cccc3ccccc23)cc1 |
|
~%
1-naphthalen-1-... CAS#:111782-25-3 |
| Literature: Sun, Mei-Zhen; Wu, Fang-Ying; Wu, Yu-Mei; Liu, Wen-Ming Spectrochimica Acta - Part A: Molecular and Biomolecular Spectroscopy, 2008 , vol. 71, # 3 p. 814 - 817 |
|
~%
1-naphthalen-1-... CAS#:111782-25-3 |
| Literature: Dyson Journal of the Chemical Society, 1934 , p. 174,176 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-[1]Naphthyl-N'-(4-nitro-phenyl)-thioharnstoff |
| Thiourea,N-1-naphthalenyl-N'-(4-nitrophenyl) |
| N-[1]naphthyl-N'-(4-nitro-phenyl)-thiourea |