6-[[(6-aminopyridin-2-yl)amino]methylidene]-2-methoxycyclohexa-2,4-dien-1-one structure
|
Common Name | 6-[[(6-aminopyridin-2-yl)amino]methylidene]-2-methoxycyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 111844-11-2 | Molecular Weight | 243.26100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[[(6-aminopyridin-2-yl)amino]methylidene]-2-methoxycyclohexa-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13N3O2 |
|---|---|
| Molecular Weight | 243.26100 |
| Exact Mass | 243.10100 |
| PSA | 77.97000 |
| LogP | 1.63190 |
| InChIKey | JYIZRZYKAYBXEI-UHFFFAOYSA-N |
| SMILES | COc1cccc(C=Nc2cccc(N)n2)c1O |
|
~%
6-[[(6-aminopyr... CAS#:111844-11-2 |
| Literature: Goudar, T. R.; Shindagi, S. M.; Nadagouda, G. S. Journal of the Indian Chemical Society, 1987 , vol. 64, # 6 p. 361 - 362 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phenol,2-[[(6-amino-2-pyridinyl)imino]methyl]-6-methoxy |