2,7-diamino-4-phenyl-4H-chromene-3-carbonitrile structure
|
Common Name | 2,7-diamino-4-phenyl-4H-chromene-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 111861-39-3 | Molecular Weight | 263.29400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,7-diamino-4-phenyl-4H-chromene-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13N3O |
|---|---|
| Molecular Weight | 263.29400 |
| Exact Mass | 263.10600 |
| PSA | 85.06000 |
| LogP | 3.76848 |
| InChIKey | WGEMWNLLRMXKMZ-UHFFFAOYSA-N |
| SMILES | N#CC1=C(N)Oc2cc(N)ccc2C1c1ccccc1 |
|
~90%
2,7-diamino-4-p... CAS#:111861-39-3 |
| Literature: Radwan, Shaban M.; Bakhite, Etify A.; El-Dean, Adel M. Kamal Phosphorus, Sulfur and Silicon and the Related Elements, 1995 , vol. 101, # 1-4 p. 207 - 212 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,7-diamino-4-phenyl-4H-benzo[b]pyran-3-carbonitrile |
| 4H-1-Benzopyran-3-carbonitrile,2,7-diamino-4-phenyl |
| 2,7-diamino-3-cyano-4-phenyl-4H-chromene |