2,4-Dihydroxyphenylacetylasparagine structure
|
Common Name | 2,4-Dihydroxyphenylacetylasparagine | ||
|---|---|---|---|---|
| CAS Number | 111872-98-1 | Molecular Weight | 282.24900 | |
| Density | 1.51g/cm3 | Boiling Point | 779.3ºC at 760mmHg | |
| Molecular Formula | C12H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 425.1ºC | |
Use of 2,4-Dihydroxyphenylacetylasparagine2,4-Dihydroxyphenylacetylasparagine is a potent and selective antagonist of glutamate. 2,4-Dihydroxyphenylacetylasparagine inhibits glutamate binding to rat brain synaptic membranes[1]. |
| Name | 2,4-Dihydroxyphenylacetyl-L-asparagine |
|---|---|
| Synonym | More Synonyms |
| Description | 2,4-Dihydroxyphenylacetylasparagine is a potent and selective antagonist of glutamate. 2,4-Dihydroxyphenylacetylasparagine inhibits glutamate binding to rat brain synaptic membranes[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 779.3ºC at 760mmHg |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.24900 |
| Flash Point | 425.1ºC |
| Exact Mass | 282.08500 |
| PSA | 149.95000 |
| LogP | 0.17630 |
| Vapour Pressure | 1.45E-25mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | XWUFTPIDMLSXES-QMMMGPOBSA-N |
| SMILES | NC(=O)CC(NC(=O)Cc1ccc(O)cc1O)C(=O)O |
| 2,4-dihydroxyphenylacetylasparagine |