2,3-dimethoxy-5-methyl-6-(4-oxo-1-phenyl-4-thiomorpholin-4-ylbutyl)cyclohexa-2,5-diene-1,4-dione structure
|
Common Name | 2,3-dimethoxy-5-methyl-6-(4-oxo-1-phenyl-4-thiomorpholin-4-ylbutyl)cyclohexa-2,5-diene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 111885-17-7 | Molecular Weight | 429.52900 | |
| Density | 1.26g/cm3 | Boiling Point | 664ºC at 760mmHg | |
| Molecular Formula | C23H27NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 355.4ºC | |
| Name | 2,3-dimethoxy-5-methyl-6-(4-oxo-1-phenyl-4-thiomorpholin-4-ylbutyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 664ºC at 760mmHg |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.52900 |
| Flash Point | 355.4ºC |
| Exact Mass | 429.16100 |
| PSA | 98.21000 |
| LogP | 3.03640 |
| Vapour Pressure | 1.68E-17mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | IZTSBBOZJVITSZ-UHFFFAOYSA-N |
| SMILES | COC1=C(OC)C(=O)C(C(CCC(=O)N2CCSCC2)c2ccccc2)=C(C)C1=O |
|
~%
2,3-dimethoxy-5... CAS#:111885-17-7 |
| Literature: Tatsuoka; Suzuki; Imao; Satoh; Ishihara; Hirotsu; Kihara; Hatta; Horikawa; Sumoto; Miyano Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 9 p. 2382 - 2386 |
|
~%
2,3-dimethoxy-5... CAS#:111885-17-7 |
| Literature: Tatsuoka; Suzuki; Imao; Satoh; Ishihara; Hirotsu; Kihara; Hatta; Horikawa; Sumoto; Miyano Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 9 p. 2382 - 2386 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(3,4-Dimethoxy-6-methyl-2,5-benzoquinonyl)-4-phenyl-1-thiomorpholino-1-oxobutane |
| Thiomorpholine,4-(4-(4,5-dimethoxy-3,6-dioxo-2-methyl-1,4-cyclohexadien-1-yl)-1-oxo-4-phenylbutyl) |