Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]
Modify Date: 2026-09-17 22:26:50
![Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl] Structure](https://www.chemsrc.com/extcaspic/408/111908-60-2.png)
Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl] structure
|
Common Name | Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl] | ||
|---|---|---|---|---|
| CAS Number | 111908-60-2 | Molecular Weight | 376.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H20N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H20N4OS |
|---|---|
| Molecular Weight | 376.5 |
| InChIKey | JWLWCXLAZIQTDO-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1CNc1ccccc1CS(=O)c1nc2ccccc2[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]? |
| A: Molecular formula of Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl] is C21H20N4OS. |
| Q: What is the molecular weight of Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]? |
| A: Molecular weight of Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl] is 376.5. |
| Q: What is the SMILES notation of Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]? |
| A: SMILES notation of Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl] is Nc1ccccc1CNc1ccccc1CS(=O)c1nc2ccccc2[nH]1. |
| Q: What is the English name of Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]? |
| A: The English name of Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl] is Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]. |
| Q: What is the Chinese name of 111908-60-2? |
| A: Chinese name of 111908-60-2 is 111908-60-2. |
| Q: What is the CAS number of Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]? |
| A: CAS number of Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl] is 111908-60-2. |
| Q: What is the InChIKey of Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]? |
| A: InChIKey of Benzenemethanamine,2-amino-n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl] is JWLWCXLAZIQTDO-UHFFFAOYSA-N. |