Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro
Modify Date: 2026-10-01 17:54:25
![Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro Structure](https://www.chemsrc.com/extcaspic/218/111908-65-7.png)
Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro structure
|
Common Name | Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro | ||
|---|---|---|---|---|
| CAS Number | 111908-65-7 | Molecular Weight | 331.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14ClN3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14ClN3OS |
|---|---|
| Molecular Weight | 331.8 |
| InChIKey | DQKQWVYXNFCAJX-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1ccccc1CSc1nc2ccccc2[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro? |
| A: Molecular formula of Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro is C16H14ClN3OS. |
| Q: What is the molecular weight of Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro? |
| A: Molecular weight of Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro is 331.8. |
| Q: What is the SMILES notation of Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro? |
| A: SMILES notation of Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro is O=C(CCl)Nc1ccccc1CSc1nc2ccccc2[nH]1. |
| Q: What is the Chinese name of 111908-65-7? |
| A: Chinese name of 111908-65-7 is 111908-65-7. |
| Q: What is the CAS number of Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro? |
| A: CAS number of Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro is 111908-65-7. |
| Q: What is the English name of Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro? |
| A: The English name of Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro is Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro. |
| Q: What is the InChIKey of Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro? |
| A: InChIKey of Acetamide,n-[2-[(1h-benzimidazol-2-ylthio)methyl]phenyl]-2-chloro is DQKQWVYXNFCAJX-UHFFFAOYSA-N. |