1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl
Modify Date: 2025-09-15 09:14:44
![1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl Structure](https://www.chemsrc.com/extcaspic/201/111908-70-4.png)
1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl structure
|
Common Name | 1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl | ||
|---|---|---|---|---|
| CAS Number | 111908-70-4 | Molecular Weight | 411.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H25N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H25N5O2S |
|---|---|
| Molecular Weight | 411.5 |
| InChIKey | QYKAGVZQBUAMEN-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC(=O)Nc2ccccc2CS(=O)c2nc3ccccc3[nH]2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl? |
| A: Molecular formula of 1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl is C21H25N5O2S. |
| Q: What is the molecular weight of 1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl? |
| A: Molecular weight of 1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl is 411.5. |
| Q: What is the English name of 1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl? |
| A: The English name of 1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl is 1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl. |
| Q: What is the Chinese name of 111908-70-4? |
| A: Chinese name of 111908-70-4 is 111908-70-4. |
| Q: What is the InChIKey of 1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl? |
| A: InChIKey of 1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl is QYKAGVZQBUAMEN-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl? |
| A: SMILES notation of 1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl is CN1CCN(CC(=O)Nc2ccccc2CS(=O)c2nc3ccccc3[nH]2)CC1. |
| Q: What is the CAS number of 1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl? |
| A: CAS number of 1-Piperazineacetamide,n-[2-[(1h-benzimidazol-2-ylsulfinyl)methyl]phenyl]-4-methyl is 111908-70-4. |