2-(4-methoxyphenyl)-3-(4-pyridyl)-6,7-dihydro-(5H)-pyrrolo(1,2-a)imidazole structure
|
Common Name | 2-(4-methoxyphenyl)-3-(4-pyridyl)-6,7-dihydro-(5H)-pyrrolo(1,2-a)imidazole | ||
|---|---|---|---|---|
| CAS Number | 111908-95-3 | Molecular Weight | 291.34700 | |
| Density | 1.24g/cm3 | Boiling Point | 489.7ºC at 760 mmHg | |
| Molecular Formula | C18H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.9ºC | |
| Name | 2-(4-methoxyphenyl)-3-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 489.7ºC at 760 mmHg |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.34700 |
| Flash Point | 249.9ºC |
| Exact Mass | 291.13700 |
| PSA | 39.94000 |
| LogP | 3.56690 |
| Vapour Pressure | 2.93E-09mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | UIJWMSUSZQORDJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc3n(c2-c2ccncc2)CCC3)cc1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Name: D3R2021 from Article : "Drug Design Data Resource Grand Challenge 3 Dataset: VEGFR2"
Source: BindingDB
Target: N/A
External Id: BindingDB_11026_1
|
|
Name: GSK PKIS2: Screen against O. lienalis microfilariae, single point, at 3.1uM to assess...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3988182
|
|
Name: D3R2022 from Article : "Drug Design Data Resource Grand Challenge 3 Dataset: JAK2_SC2...
Source: BindingDB
Target: N/A
External Id: BindingDB_11027_1
|