tributyl-(1-ethoxy-3-phenylprop-2-ynyl)stannane structure
|
Common Name | tributyl-(1-ethoxy-3-phenylprop-2-ynyl)stannane | ||
|---|---|---|---|---|
| CAS Number | 111949-08-7 | Molecular Weight | 449.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H38OSn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tributyl-(1-ethoxy-3-phenylprop-2-ynyl)stannane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H38OSn |
|---|---|
| Molecular Weight | 449.24800 |
| Exact Mass | 450.19400 |
| PSA | 9.23000 |
| LogP | 6.43100 |
| InChIKey | XOQJXUAYLLQEDZ-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(C#Cc1ccccc1)OCC |
|
~%
tributyl-(1-eth... CAS#:111949-08-7 |
| Literature: Duchene, Alain; Quintard, Jean-Paul Journal of the Chemical Society, Chemical Communications, 1987 , # 1 p. 29 - 30 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Stannane,tributyl(1-ethoxy-3-phenyl-2-propynyl) |