|
I+/--(4-Chlorophenyl)-1H-1,2,4-triazole-1-ethanamine structure
|
Common Name | I+/--(4-Chlorophenyl)-1H-1,2,4-triazole-1-ethanamine | ||
|---|---|---|---|---|
| CAS Number | 111953-16-3 | Molecular Weight | 222.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | I+/--(4-Chlorophenyl)-1H-1,2,4-triazole-1-ethanamine |
|---|
| Molecular Formula | C10H11ClN4 |
|---|---|
| Molecular Weight | 222.67 |