4-Benzoylphenyl cyclopropanecarboxylate
Modify Date: 2025-08-27 18:07:08
4-Benzoylphenyl cyclopropanecarboxylate structure
|
Common Name | 4-Benzoylphenyl cyclopropanecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 112005-17-1 | Molecular Weight | 266.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Benzoylphenyl cyclopropanecarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H14O3 |
|---|---|
| Molecular Weight | 266.29 |
| InChIKey | MDYZFKYRXIIHLW-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(OC(=O)C2CC2)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibitory activity against human leukocyte elastase at 10e-6 M
Source: ChEMBL
Target: Neutrophil elastase
External Id: CHEMBL675722
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-Benzoylphenyl cyclopropanecarboxylate? |
| A: CAS number of 4-Benzoylphenyl cyclopropanecarboxylate is 112005-17-1. |
| Q: What is the InChIKey of 4-Benzoylphenyl cyclopropanecarboxylate? |
| A: InChIKey of 4-Benzoylphenyl cyclopropanecarboxylate is MDYZFKYRXIIHLW-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 112005-17-1? |
| A: Chinese name of 112005-17-1 is 112005-17-1. |
| Q: What is the molecular weight of 4-Benzoylphenyl cyclopropanecarboxylate? |
| A: Molecular weight of 4-Benzoylphenyl cyclopropanecarboxylate is 266.29. |
| Q: What is the molecular formula of 4-Benzoylphenyl cyclopropanecarboxylate? |
| A: Molecular formula of 4-Benzoylphenyl cyclopropanecarboxylate is C17H14O3. |
| Q: What is the English name of 4-Benzoylphenyl cyclopropanecarboxylate? |
| A: The English name of 4-Benzoylphenyl cyclopropanecarboxylate is 4-Benzoylphenyl cyclopropanecarboxylate. |
| Q: What is the SMILES notation of 4-Benzoylphenyl cyclopropanecarboxylate? |
| A: SMILES notation of 4-Benzoylphenyl cyclopropanecarboxylate is O=C(c1ccccc1)c1ccc(OC(=O)C2CC2)cc1. |