N-[2-(dimethylamino)ethyl]-9-oxothioxanthene-4-carboxamide structure
|
Common Name | N-[2-(dimethylamino)ethyl]-9-oxothioxanthene-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 112022-07-8 | Molecular Weight | 326.41300 | |
| Density | 1.259g/cm3 | Boiling Point | 496.1ºC at 760mmHg | |
| Molecular Formula | C18H18N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.8ºC | |
| Name | N-[2-(dimethylamino)ethyl]-9-oxothioxanthene-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.259g/cm3 |
|---|---|
| Boiling Point | 496.1ºC at 760mmHg |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.41300 |
| Flash Point | 253.8ºC |
| Exact Mass | 326.10900 |
| PSA | 81.14000 |
| LogP | 3.28090 |
| Vapour Pressure | 5.59E-10mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | GSRITSVNVVVOBJ-UHFFFAOYSA-N |
| SMILES | CN(C)CCNC(=O)c1cccc2c(=O)c3ccccc3sc12 |
|
~%
N-[2-(dimethyla... CAS#:112022-07-8 |
| Literature: Palmer; Rewcastle; Atwell; Baguley; Denny Journal of Medicinal Chemistry, 1988 , vol. 31, # 4 p. 707 - 712 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-(2-(Dimethylamino)ethyl)-9-oxo-9H-thioxanthene-4-carboxamide |
| 9H-Thioxanthene-4-carboxamide,N-(2-(dimethylamino)ethyl)-9-oxo |
| N-(2-dimethylaminoethyl)-9-oxothioxanthene-4-carboxamide |