N-[2-(dimethylamino)ethyl]phenoxathiine-1-carboxamide structure
|
Common Name | N-[2-(dimethylamino)ethyl]phenoxathiine-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 112022-14-7 | Molecular Weight | 314.40200 | |
| Density | 1.239g/cm3 | Boiling Point | 452.5ºC at 760mmHg | |
| Molecular Formula | C17H18N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.4ºC | |
| Name | N-[2-(dimethylamino)ethyl]phenoxathiine-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.239g/cm3 |
|---|---|
| Boiling Point | 452.5ºC at 760mmHg |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.40200 |
| Flash Point | 227.4ºC |
| Exact Mass | 314.10900 |
| PSA | 70.36000 |
| LogP | 3.80970 |
| Vapour Pressure | 2.24E-08mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | OXLBMHDCQZQZCM-UHFFFAOYSA-N |
| SMILES | CN(C)CCNC(=O)c1cccc2c1Sc1ccccc1O2 |
|
~%
N-[2-(dimethyla... CAS#:112022-14-7 |
| Literature: Palmer; Rewcastle; Atwell; Baguley; Denny Journal of Medicinal Chemistry, 1988 , vol. 31, # 4 p. 707 - 712 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-(2-dimethylaminoethyl)phenoxathiine-1-carboxamide |
| N-(2-Dimethylaminoethyl)-1-phenoxathiincarboxamide |