5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride
![5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride Structure](https://image.chemsrc.com/caspic/490/112101-75-4.png)
5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride structure
|
Common Name | 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 112101-75-4 | Molecular Weight | 280.77200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17ClN2O3S | Melting Point | 103-105ºC | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | 103-105ºC |
|---|---|
| Molecular Formula | C10H17ClN2O3S |
| Molecular Weight | 280.77200 |
| Exact Mass | 280.06500 |
| PSA | 103.79000 |
| LogP | 3.51570 |
| InChIKey | KYRRNJIOCLALJQ-OGFXRTJISA-N |
| SMILES | COc1ccc(CC(C)N)cc1S(N)(=O)=O.Cl |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2935009090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (R)-5-(2-Aminopropyl)-2-methoxybenzenesulfonamide hydrochloride |
| 5-[(2R)-2-aminopropyl]-2-methoxybenzenesulfonamide,hydrochloride |
| Tamsulosin Impurity 11 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride? |
| A: CAS number of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride is 112101-75-4. |
| Q: What is the InChIKey of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride? |
| A: InChIKey of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride is KYRRNJIOCLALJQ-OGFXRTJISA-N. |
| Q: What is the molecular formula of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride? |
| A: Molecular formula of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride is C10H17ClN2O3S. |
| Q: What is the molecular weight of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride? |
| A: Molecular weight of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride is 280.77200. |
| Q: What is the LogP of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride? |
| A: LogP of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride is 3.51570. |
| Q: What is the polar surface area (PSA) of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride? |
| A: Polar surface area (PSA) of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride is 103.79000. |
| Q: What English synonyms does 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride have? |
| A: English synonyms of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride: (R)-5-(2-Aminopropyl)-2-methoxybenzenesulfonamide hydrochloride, 5-[(2R)-2-aminopropyl]-2-methoxybenzenesulfonamide,hydrochloride, Tamsulosin Impurity 11. |
| Q: What is the English name of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride? |
| A: The English name of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride is 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride. |
| Q: What is the melting point of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride? |
| A: Melting point of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride is 103-105ºC. |
| Q: What is the SMILES notation of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride? |
| A: SMILES notation of 5[(R)-(2-Aminopropyl)]-2-methoxybenzenesulfonamide Hydrochloride is COc1ccc(CC(C)N)cc1S(N)(=O)=O.Cl. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |