L-Phenylalaninamide, L-alanyl-N-methyl
Modify Date: 2026-07-16 18:04:07
L-Phenylalaninamide, L-alanyl-N-methyl structure
|
Common Name | L-Phenylalaninamide, L-alanyl-N-methyl | ||
|---|---|---|---|---|
| CAS Number | 112237-76-0 | Molecular Weight | 249.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | L-Phenylalaninamide, L-alanyl-N-methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19N3O2 |
|---|---|
| Molecular Weight | 249.31 |
| InChIKey | SFQOEBNXTQWYNX-ONGXEEELSA-N |
| SMILES | CNC(=O)C(Cc1ccccc1)NC(=O)C(C)N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of L-Phenylalaninamide, L-alanyl-N-methyl? |
| A: Molecular formula of L-Phenylalaninamide, L-alanyl-N-methyl is C13H19N3O2. |
| Q: What is the CAS number of L-Phenylalaninamide, L-alanyl-N-methyl? |
| A: CAS number of L-Phenylalaninamide, L-alanyl-N-methyl is 112237-76-0. |
| Q: What is the Chinese name of 112237-76-0? |
| A: Chinese name of 112237-76-0 is 112237-76-0. |
| Q: What is the SMILES notation of L-Phenylalaninamide, L-alanyl-N-methyl? |
| A: SMILES notation of L-Phenylalaninamide, L-alanyl-N-methyl is CNC(=O)C(Cc1ccccc1)NC(=O)C(C)N. |
| Q: What is the InChIKey of L-Phenylalaninamide, L-alanyl-N-methyl? |
| A: InChIKey of L-Phenylalaninamide, L-alanyl-N-methyl is SFQOEBNXTQWYNX-ONGXEEELSA-N. |
| Q: What is the molecular weight of L-Phenylalaninamide, L-alanyl-N-methyl? |
| A: Molecular weight of L-Phenylalaninamide, L-alanyl-N-methyl is 249.31. |
| Q: What is the English name of L-Phenylalaninamide, L-alanyl-N-methyl? |
| A: The English name of L-Phenylalaninamide, L-alanyl-N-methyl is L-Phenylalaninamide, L-alanyl-N-methyl. |