(Rac)-O-Desmethylnaproxen-d3 structure
|
Common Name | (Rac)-O-Desmethylnaproxen-d3 | ||
|---|---|---|---|---|
| CAS Number | 1122399-99-8 | Molecular Weight | 219.25100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9D3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | rac O-Desmethyl Naproxen-d3 |
|---|---|
| Synonym | More Synonyms |
| Description |
|---|
| Molecular Formula | C13H9D3O3 |
|---|---|
| Molecular Weight | 219.25100 |
| Exact Mass | 219.09700 |
| PSA | 57.53000 |
| LogP | 2.73350 |
| InChIKey | XWJUDDGELKXYNO-FIBGUPNXSA-N |
| SMILES | CC(C(=O)O)c1ccc2cc(O)ccc2c1 |
|
~%
(Rac)-O-Desmeth... CAS#:1122399-99-8 |
| Literature: AUSPEX PHARMACEUTICALS, INC.; RAO, Tadimeti; ZHANG, Chengzhi; GANT, Thomas, G.; SARSHAR, Sepehr Patent: WO2010/129505 A2, 2010 ; Location in patent: Page/Page column 38 ; WO 2010/129505 A2 |
|
~30%
(Rac)-O-Desmeth... CAS#:1122399-99-8 |
| Literature: Fontana; Venegoni Journal of Labelled Compounds and Radiopharmaceuticals, 2008 , vol. 51, # 5 p. 239 - 241 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,3,3-trideuterio-2-(6-hydroxynaphthalen-2-yl)propanoic acid |