3-[4-[2-(2,6-Dichloro-4-methylphenoxy)ethoxy]phenyl]-2-[4-[2-(3-methoxypropyl)phenyl]-2-methylphenyl]propan-1-amine structure
|
Common Name | 3-[4-[2-(2,6-Dichloro-4-methylphenoxy)ethoxy]phenyl]-2-[4-[2-(3-methoxypropyl)phenyl]-2-methylphenyl]propan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 1122568-05-1 | Molecular Weight | 592.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H39Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[4-[2-(2,6-Dichloro-4-methylphenoxy)ethoxy]phenyl]-2-[4-[2-(3-methoxypropyl)phenyl]-2-methylphenyl]propan-1-amine |
|---|
| Molecular Formula | C35H39Cl2NO3 |
|---|---|
| Molecular Weight | 592.6 |
| InChIKey | FYTLUEKLGKTLOF-UHFFFAOYSA-N |
| SMILES | COCCCc1ccccc1-c1ccc(C(CN)Cc2ccc(OCCOc3c(Cl)cc(C)cc3Cl)cc2)c(C)c1 |
|
Name: Inhibition of human recombinant renin in plasma
Source: ChEMBL
Target: Renin
External Id: CHEMBL1259494
|
|
Name: Inhibition of human recombinant renin in phosphate buffer
Source: ChEMBL
Target: Renin
External Id: CHEMBL1259493
|