1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane
1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane structure
|
Common Name | 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane | ||
|---|---|---|---|---|
| CAS Number | 112331-99-4 | Molecular Weight | 265.87300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H3Cl4F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C4H3Cl4F3O |
|---|---|
| Molecular Weight | 265.87300 |
| Exact Mass | 263.88900 |
| PSA | 9.23000 |
| LogP | 3.50040 |
| InChIKey | ZYOLZDSIDVCFRU-UHFFFAOYSA-N |
| SMILES | COC(Cl)(Cl)C(Cl)(Cl)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~54%
1,1,2,2-tetrach... CAS#:112331-99-4 |
| Literature: Pashkevich, Kazimir I.; Saloutin, Victor I.; Bobrov, Maksim B. Journal of Fluorine Chemistry, 1988 , vol. 41, p. 421 - 424 |
|
~56%
1,1,2,2-tetrach... CAS#:112331-99-4 |
| Literature: Saloumin, V. I.; Bobrov, M. B.; Pashkevich, K. I. Journal of Organic Chemistry USSR (English Translation), 1987 , vol. 23, # 4 p. 807 - 808 Zhurnal Organicheskoi Khimii, 1987 , vol. 23, # 4 p. 892 - 893 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Propane,1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxy |
| 3,3,3-trifluoro-1,1,2,2-tetrachloro-1-methoxypropane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane? |
| A: InChIKey of 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane is ZYOLZDSIDVCFRU-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane? |
| A: Molecular formula of 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane is C4H3Cl4F3O. |
| Q: What English synonyms does 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane have? |
| A: English synonyms of 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane: Propane,1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxy, 3,3,3-trifluoro-1,1,2,2-tetrachloro-1-methoxypropane. |
| Q: What is the polar surface area (PSA) of 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane? |
| A: Polar surface area (PSA) of 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane is 9.23000. |
| Q: What is the molecular weight of 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane? |
| A: Molecular weight of 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane is 265.87300. |
| Q: What is the LogP of 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane? |
| A: LogP of 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane is 3.50040. |
| Q: What are the upstream materials of 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane? |
| A: Related upstream materials(CAS) of 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane: 13089-11-7. |
| Q: What is the CAS number of 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane? |
| A: CAS number of 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane is 112331-99-4. |
| Q: What is the SMILES notation of 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane? |
| A: SMILES notation of 1,1,2,2-tetrachloro-3,3,3-trifluoro-1-methoxypropane is COC(Cl)(Cl)C(Cl)(Cl)C(F)(F)F. |
| Q: What is the Chinese name of 112331-99-4? |
| A: Chinese name of 112331-99-4 is 112331-99-4. |