1,2,3a,8b-tetramethylcyclopenta[a]indene-3,4-dione structure
|
Common Name | 1,2,3a,8b-tetramethylcyclopenta[a]indene-3,4-dione | ||
|---|---|---|---|---|
| CAS Number | 112532-32-8 | Molecular Weight | 240.29700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,3a,8b-tetramethylcyclopenta[a]indene-3,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16O2 |
|---|---|
| Molecular Weight | 240.29700 |
| Exact Mass | 240.11500 |
| PSA | 34.14000 |
| LogP | 3.06600 |
| InChIKey | LLRYCYWQEOXVNW-UHFFFAOYSA-N |
| SMILES | CC1=C(C)C2(C)c3ccccc3C(=O)C2(C)C1=O |
|
~%
1,2,3a,8b-tetra... CAS#:112532-32-8 |
| Literature: Schoetz,K.; Clark,T.; Schleyer,P.R. Journal of the American Chemical Society, 1988 , vol. 110, p. 1394 |
|
~%
1,2,3a,8b-tetra... CAS#:112532-32-8 |
| Literature: Schoetz,K.; Clark,T.; Schleyer,P.R. Journal of the American Chemical Society, 1988 , vol. 110, p. 1394 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Cyclopent[a]indene-1,8-dione,3a,8a-dihydro-2,3,3a,8a-tetramethyl |
| 1,3,4,5,-tetramethyl-2,10-dioxobenzobicyclo<3.3.0>octa-3,5a-diene |